About 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine
2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine (PubChem CID 65152932) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine |
| PubChem CID | 65152932 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine |
| SMILES | Cc1oc(C)c(CNCC(C)C)c1C |
| InChI | InChI=1S/C12H21NO/c1-8(2)6-13-7-12-9(3)10(4)14-11(12)5/h8,13H,6-7H2,1-5H3 |
| InChIKey | PERHLUIWXBUVSE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine?
The IUPAC name of 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine (CID 65152932) is 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine.
What is the SMILES notation for 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine?
The canonical SMILES for 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine is Cc1oc(C)c(CNCC(C)C)c1C.
What is the InChIKey of 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine?
The InChIKey is PERHLUIWXBUVSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-8(2)6-13-7-12-9(3)10(4)14-11(12)5/h8,13H,6-7H2,1-5H3.
What are the key properties of 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine?
2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine has a molecular weight of 195.31 g/mol, XLogP of 2.95, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(2,4,5-trimethylfuran-3-yl)methyl]propan-1-amine is sourced from PubChem (CID 65152932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).