C9H10N2O2S — CID 65152956
5-(2,4,5-trimethylfuran-3-yl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 65152956) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-(2,4,5-trimethylfuran-3-yl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2,4,5-trimethylfuran-3-yl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 65152956 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-(2,4,5-trimethylfuran-3-yl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | Cc1oc(C)c(-c2n[nH]c(=S)o2)c1C |
| InChI | InChI=1S/C9H10N2O2S/c1-4-5(2)12-6(3)7(4)8-10-11-9(14)13-8/h1-3H3,(H,11,14) |
| InChIKey | JBBIZBVGQGTKNO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|