C15H18O3 — CID 65153068
(4-methoxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanol (PubChem CID 65153068) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4-methoxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanol.
| Compound Name | (4-methoxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanol |
|---|---|
| PubChem CID | 65153068 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4-methoxyphenyl)-(2,4,5-trimethylfuran-3-yl)methanol |
| SMILES | COc1ccc(C(O)c2c(C)oc(C)c2C)cc1 |
| InChI | InChI=1S/C15H18O3/c1-9-10(2)18-11(3)14(9)15(16)12-5-7-13(17-4)8-6-12/h5-8,15-16H,1-4H3 |
| InChIKey | MBDVVIGKZDMEMO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |