C13H18N2O2S — CID 65153528
1-(2,4,5-trimethylfuran-3-carbonyl)pyrrolidine-2-carbothioamide (PubChem CID 65153528) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-(2,4,5-trimethylfuran-3-carbonyl)pyrrolidine-2-carbothioamide.
| Compound Name | 1-(2,4,5-trimethylfuran-3-carbonyl)pyrrolidine-2-carbothioamide |
|---|---|
| PubChem CID | 65153528 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(2,4,5-trimethylfuran-3-carbonyl)pyrrolidine-2-carbothioamide |
| SMILES | Cc1oc(C)c(C(=O)N2CCCC2C(N)=S)c1C |
| InChI | InChI=1S/C13H18N2O2S/c1-7-8(2)17-9(3)11(7)13(16)15-6-4-5-10(15)12(14)18/h10H,4-6H2,1-3H3,(H2,14,18) |
| InChIKey | CENTZWNLSMTDNA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|