C14H22OS — CID 65153793
3,5-dimethyl-1-(2-thiophen-2-ylethyl)cyclohexan-1-ol (PubChem CID 65153793) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2-thiophen-2-ylethyl)cyclohexan-1-ol.
| Compound Name | 3,5-dimethyl-1-(2-thiophen-2-ylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 65153793 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 3,5-dimethyl-1-(2-thiophen-2-ylethyl)cyclohexan-1-ol |
| SMILES | CC1CC(C)CC(O)(CCc2cccs2)C1 |
| InChI | InChI=1S/C14H22OS/c1-11-8-12(2)10-14(15,9-11)6-5-13-4-3-7-16-13/h3-4,7,11-12,15H,5-6,8-10H2,1-2H3 |
| InChIKey | MHKKJNFWRIWVFZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |