C10H19NO2 — CID 65155196
N-ethyl-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65155196) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is N-ethyl-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-ethyl-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 65155196 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | N-ethyl-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CCNC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C10H19NO2/c1-5-11-10(12)9-6(2)7(3)13-8(9)4/h6-9H,5H2,1-4H3,(H,11,12) |
| InChIKey | SJZPKWSLBPPEST-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |