C44H28N4Zn — CID 6515536
zinc 5,10,15,20-tetraphenyl-2H-porphyrin-2,15-diide (PubChem CID 6515536) has the molecular formula C44H28N4Zn and a molecular weight of 678.13 g/mol. Its IUPAC name is zinc 5,10,15,20-tetraphenyl-2H-porphyrin-2,15-diide.
| Compound Name | zinc 5,10,15,20-tetraphenyl-2H-porphyrin-2,15-diide |
|---|---|
| PubChem CID | 6515536 |
| Molecular Formula | C44H28N4Zn |
| Molecular Weight | 678.13 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | zinc 5,10,15,20-tetraphenyl-2H-porphyrin-2,15-diide |
| SMILES | C1=C/C2=C(\c3ccccc3)c3c[cH-]c(n3)/C(c3ccccc3)=C3/C=CC(=N3)[C-](c3ccccc3)C3=N/C(=C(/c4ccccc4)C1=N2)C=C3.[Zn+2] |
| InChI | InChI=1S/C44H28N4.Zn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+2/b41-33-,42-37-,43-38-; |
| InChIKey | XPVVGUHKLPZAEN-IEFYFFAASA-N |
| XLogP | 9.40 |
| TPSA | 49.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.13 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|