About 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile
2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile (PubChem CID 65155372) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile.
Molecular Properties
| Compound Name | 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile |
| PubChem CID | 65155372 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile |
| SMILES | CCC(C#N)C(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C12H19NO2/c1-5-10(6-13)12(14)11-7(2)8(3)15-9(11)4/h7-11H,5H2,1-4H3 |
| InChIKey | KQDASPKJKILECV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile?
The IUPAC name of 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile (CID 65155372) is 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile.
What is the SMILES notation for 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile?
The canonical SMILES for 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile is CCC(C#N)C(=O)C1C(C)OC(C)C1C.
What is the InChIKey of 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile?
The InChIKey is KQDASPKJKILECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-5-10(6-13)12(14)11-7(2)8(3)15-9(11)4/h7-11H,5H2,1-4H3.
What are the key properties of 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile?
2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile has a molecular weight of 209.29 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,5-trimethyloxolane-3-carbonyl)butanenitrile is sourced from PubChem (CID 65155372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).