About N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide
N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65155454) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide |
| PubChem CID | 65155454 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CCONC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C10H19NO3/c1-5-13-11-10(12)9-6(2)7(3)14-8(9)4/h6-9H,5H2,1-4H3,(H,11,12) |
| InChIKey | RPPHGMWDLAXRIB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide?
The IUPAC name of N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide (CID 65155454) is N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide.
What is the SMILES notation for N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide?
The canonical SMILES for N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide is CCONC(=O)C1C(C)OC(C)C1C.
What is the InChIKey of N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide?
The InChIKey is RPPHGMWDLAXRIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-5-13-11-10(12)9-6(2)7(3)14-8(9)4/h6-9H,5H2,1-4H3,(H,11,12).
What are the key properties of N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide?
N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide has a molecular weight of 201.27 g/mol, XLogP of 1.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-2,4,5-trimethyloxolane-3-carboxamide is sourced from PubChem (CID 65155454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).