About N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide
N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65155679) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide |
| PubChem CID | 65155679 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)NO)C1C |
| InChI | InChI=1S/C8H15NO3/c1-4-5(2)12-6(3)7(4)8(10)9-11/h4-7,11H,1-3H3,(H,9,10) |
| InChIKey | FIJNMDRIAVHVHL-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide?
The IUPAC name of N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide (CID 65155679) is N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide.
What is the SMILES notation for N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide?
The canonical SMILES for N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide is CC1OC(C)C(C(=O)NO)C1C.
What is the InChIKey of N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide?
The InChIKey is FIJNMDRIAVHVHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-4-5(2)12-6(3)7(4)8(10)9-11/h4-7,11H,1-3H3,(H,9,10).
What are the key properties of N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide?
N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide has a molecular weight of 173.21 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2,4,5-trimethyloxolane-3-carboxamide is sourced from PubChem (CID 65155679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).