About N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide
N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide (PubChem CID 65155810) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide |
| PubChem CID | 65155810 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)N(CCO)C(C)C)C1C |
| InChI | InChI=1S/C13H25NO3/c1-8(2)14(6-7-15)13(16)12-9(3)10(4)17-11(12)5/h8-12,15H,6-7H2,1-5H3 |
| InChIKey | PPLCDEOESUKAEX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide?
The IUPAC name of N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide (CID 65155810) is N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide.
What is the SMILES notation for N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide?
The canonical SMILES for N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide is CC1OC(C)C(C(=O)N(CCO)C(C)C)C1C.
What is the InChIKey of N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide?
The InChIKey is PPLCDEOESUKAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-8(2)14(6-7-15)13(16)12-9(3)10(4)17-11(12)5/h8-12,15H,6-7H2,1-5H3.
What are the key properties of N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide?
N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide has a molecular weight of 243.35 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-2,4,5-trimethyl-N-propan-2-yloxolane-3-carboxamide is sourced from PubChem (CID 65155810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).