About N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide
N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65156063) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide |
| PubChem CID | 65156063 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC(C#N)CNC(=O)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C12H20N2O2/c1-7(5-13)6-14-12(15)11-8(2)9(3)16-10(11)4/h7-11H,6H2,1-4H3,(H,14,15) |
| InChIKey | BRVVPMWKPINKAC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide?
The IUPAC name of N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide (CID 65156063) is N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide.
What is the SMILES notation for N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide?
The canonical SMILES for N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide is CC(C#N)CNC(=O)C1C(C)OC(C)C1C.
What is the InChIKey of N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide?
The InChIKey is BRVVPMWKPINKAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-7(5-13)6-14-12(15)11-8(2)9(3)16-10(11)4/h7-11H,6H2,1-4H3,(H,14,15).
What are the key properties of N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide?
N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide has a molecular weight of 224.30 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanopropyl)-2,4,5-trimethyloxolane-3-carboxamide is sourced from PubChem (CID 65156063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).