C14H25NO — CID 65156148
1-(cyclopenten-1-yl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine (PubChem CID 65156148) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-(cyclopenten-1-yl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine.
| Compound Name | 1-(cyclopenten-1-yl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 65156148 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-(cyclopenten-1-yl)-N-methyl-1-(2,4,5-trimethyloxolan-3-yl)methanamine |
| SMILES | CNC(C1=CCCC1)C1C(C)OC(C)C1C |
| InChI | InChI=1S/C14H25NO/c1-9-10(2)16-11(3)13(9)14(15-4)12-7-5-6-8-12/h7,9-11,13-15H,5-6,8H2,1-4H3 |
| InChIKey | WCQAFZPJDONHCG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|