C12H21N7 — CID 651563
[4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-propylcyanamide (PubChem CID 651563) has the molecular formula C12H21N7 and a molecular weight of 263.35 g/mol. Its IUPAC name is [4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-propylcyanamide.
| Compound Name | [4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-propylcyanamide |
|---|---|
| PubChem CID | 651563 |
| Molecular Formula | C12H21N7 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | [4-(ethylamino)-6-(propan-2-ylamino)-1,3,5-triazin-2-yl]-propylcyanamide |
| SMILES | CCCN(C#N)c1nc(NCC)nc(NC(C)C)n1 |
| InChI | InChI=1S/C12H21N7/c1-5-7-19(8-13)12-17-10(14-6-2)16-11(18-12)15-9(3)4/h9H,5-7H2,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | KICCWINJKBTCLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|