About cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine
cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine (PubChem CID 65156793) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine.
Molecular Properties
| Compound Name | cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine |
| PubChem CID | 65156793 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine |
| SMILES | CC1OC(C)C(C(N)C2=CCCCC2)C1C |
| InChI | InChI=1S/C14H25NO/c1-9-10(2)16-11(3)13(9)14(15)12-7-5-4-6-8-12/h7,9-11,13-14H,4-6,8,15H2,1-3H3 |
| InChIKey | IRHQDUWMQVROAT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine?
The IUPAC name of cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine (CID 65156793) is cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine.
What is the SMILES notation for cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine?
The canonical SMILES for cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine is CC1OC(C)C(C(N)C2=CCCCC2)C1C.
What is the InChIKey of cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine?
The InChIKey is IRHQDUWMQVROAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-9-10(2)16-11(3)13(9)14(15)12-7-5-4-6-8-12/h7,9-11,13-14H,4-6,8,15H2,1-3H3.
What are the key properties of cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine?
cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine has a molecular weight of 223.36 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexen-1-yl-(2,4,5-trimethyloxolan-3-yl)methanamine is sourced from PubChem (CID 65156793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).