About 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one (PubChem CID 651568) has the molecular formula C20H17NO4
and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one |
| PubChem CID | 651568 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one |
| SMILES | COc1ccc2oc(=O)c(C(=O)N3CCCc4ccccc43)cc2c1 |
| InChI | InChI=1S/C20H17NO4/c1-24-15-8-9-18-14(11-15)12-16(20(23)25-18)19(22)21-10-4-6-13-5-2-3-7-17(13)21/h2-3,5,7-9,11-12H,4,6,10H2,1H3 |
| InChIKey | GZLOAUXBFCRVBF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one?
The IUPAC name of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one (CID 651568) is 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one.
What is the SMILES notation for 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one?
The canonical SMILES for 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one is COc1ccc2oc(=O)c(C(=O)N3CCCc4ccccc43)cc2c1.
What is the InChIKey of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one?
The InChIKey is GZLOAUXBFCRVBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO4/c1-24-15-8-9-18-14(11-15)12-16(20(23)25-18)19(22)21-10-4-6-13-5-2-3-7-17(13)21/h2-3,5,7-9,11-12H,4,6,10H2,1H3.
What are the key properties of 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one?
3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one has a molecular weight of 335.36 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-quinoline-1-carbonyl)-6-methoxychromen-2-one is sourced from PubChem (CID 651568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).