C17H25ClO — CID 65157605
2-[2-chloro-2-(2,3,4,5,6-pentamethylphenyl)ethyl]oxolane (PubChem CID 65157605) has the molecular formula C17H25ClO and a molecular weight of 280.84 g/mol. Its IUPAC name is 2-[2-chloro-2-(2,3,4,5,6-pentamethylphenyl)ethyl]oxolane.
| Compound Name | 2-[2-chloro-2-(2,3,4,5,6-pentamethylphenyl)ethyl]oxolane |
|---|---|
| PubChem CID | 65157605 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[2-chloro-2-(2,3,4,5,6-pentamethylphenyl)ethyl]oxolane |
| SMILES | Cc1c(C)c(C)c(C(Cl)CC2CCCO2)c(C)c1C |
| InChI | InChI=1S/C17H25ClO/c1-10-11(2)13(4)17(14(5)12(10)3)16(18)9-15-7-6-8-19-15/h15-16H,6-9H2,1-5H3 |
| InChIKey | CTCLJCXIRBXVOS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|