C17H21BrN2O — CID 65157974
4-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-1-phenylpyrazole (PubChem CID 65157974) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is 4-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-1-phenylpyrazole.
| Compound Name | 4-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-1-phenylpyrazole |
|---|---|
| PubChem CID | 65157974 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[bromo-(2,4,5-trimethyloxolan-3-yl)methyl]-1-phenylpyrazole |
| SMILES | CC1OC(C)C(C(Br)c2cnn(-c3ccccc3)c2)C1C |
| InChI | InChI=1S/C17H21BrN2O/c1-11-12(2)21-13(3)16(11)17(18)14-9-19-20(10-14)15-7-5-4-6-8-15/h4-13,16-17H,1-3H3 |
| InChIKey | FJTBQRUGXGZOBA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|