C11H22N2O4S — CID 65159364
2,4,5-trimethyl-N-(3-sulfamoylpropyl)oxolane-3-carboxamide (PubChem CID 65159364) has the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. Its IUPAC name is 2,4,5-trimethyl-N-(3-sulfamoylpropyl)oxolane-3-carboxamide.
| Compound Name | 2,4,5-trimethyl-N-(3-sulfamoylpropyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 65159364 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2,4,5-trimethyl-N-(3-sulfamoylpropyl)oxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)NCCCS(N)(=O)=O)C1C |
| InChI | InChI=1S/C11H22N2O4S/c1-7-8(2)17-9(3)10(7)11(14)13-5-4-6-18(12,15)16/h7-10H,4-6H2,1-3H3,(H,13,14)(H2,12,15,16) |
| InChIKey | BQWIWIRNVWDZSL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|