C17H21N3O — CID 65159654
1-(2-methylpropyl)-2-(oxolan-2-ylmethyl)benzimidazole-5-carbonitrile (PubChem CID 65159654) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-(2-methylpropyl)-2-(oxolan-2-ylmethyl)benzimidazole-5-carbonitrile.
| Compound Name | 1-(2-methylpropyl)-2-(oxolan-2-ylmethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 65159654 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-(2-methylpropyl)-2-(oxolan-2-ylmethyl)benzimidazole-5-carbonitrile |
| SMILES | CC(C)Cn1c(CC2CCCO2)nc2cc(C#N)ccc21 |
| InChI | InChI=1S/C17H21N3O/c1-12(2)11-20-16-6-5-13(10-18)8-15(16)19-17(20)9-14-4-3-7-21-14/h5-6,8,12,14H,3-4,7,9,11H2,1-2H3 |
| InChIKey | BBUNOYHROLAWAY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |