About 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one
3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one (PubChem CID 651604) has the molecular formula C17H9BrN2O3
and a molecular weight of 369.17 g/mol. Its IUPAC name is 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one.
Molecular Properties
| Compound Name | 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one |
| PubChem CID | 651604 |
| Molecular Formula | C17H9BrN2O3 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1nnc(-c2cccc(Br)c2)o1 |
| InChI | InChI=1S/C17H9BrN2O3/c18-12-6-3-5-11(8-12)15-19-20-16(23-15)13-9-10-4-1-2-7-14(10)22-17(13)21/h1-9H |
| InChIKey | LIXGJKMGQNZIHA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one?
The IUPAC name of 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one (CID 651604) is 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one.
What is the SMILES notation for 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one?
The canonical SMILES for 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one is O=c1oc2ccccc2cc1-c1nnc(-c2cccc(Br)c2)o1.
What is the InChIKey of 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one?
The InChIKey is LIXGJKMGQNZIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9BrN2O3/c18-12-6-3-5-11(8-12)15-19-20-16(23-15)13-9-10-4-1-2-7-14(10)22-17(13)21/h1-9H.
What are the key properties of 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one?
3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one has a molecular weight of 369.17 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]chromen-2-one is sourced from PubChem (CID 651604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).