C14H18N2O3S — CID 65160497
N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 65160497) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 65160497 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[5-(3-hydroxyprop-1-ynyl)-1,3-thiazol-2-yl]-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)Nc2ncc(C#CCO)s2)C1C |
| InChI | InChI=1S/C14H18N2O3S/c1-8-9(2)19-10(3)12(8)13(18)16-14-15-7-11(20-14)5-4-6-17/h7-10,12,17H,6H2,1-3H3,(H,15,16,18) |
| InChIKey | VVOJGQYQYXZPEF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|