C12H17NO2 — CID 65161757
3-(oxolan-2-yl)-1-pyridin-2-ylpropan-1-ol (PubChem CID 65161757) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(oxolan-2-yl)-1-pyridin-2-ylpropan-1-ol.
| Compound Name | 3-(oxolan-2-yl)-1-pyridin-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 65161757 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(oxolan-2-yl)-1-pyridin-2-ylpropan-1-ol |
| SMILES | OC(CCC1CCCO1)c1ccccn1 |
| InChI | InChI=1S/C12H17NO2/c14-12(11-5-1-2-8-13-11)7-6-10-4-3-9-15-10/h1-2,5,8,10,12,14H,3-4,6-7,9H2 |
| InChIKey | USLKEMKQUFTDDY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |