C12H24N2O — CID 65162323
3,5-dimethyl-1-[2-(oxolan-2-yl)ethyl]piperazine (PubChem CID 65162323) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 3,5-dimethyl-1-[2-(oxolan-2-yl)ethyl]piperazine.
| Compound Name | 3,5-dimethyl-1-[2-(oxolan-2-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 65162323 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 3,5-dimethyl-1-[2-(oxolan-2-yl)ethyl]piperazine |
| SMILES | CC1CN(CCC2CCCO2)CC(C)N1 |
| InChI | InChI=1S/C12H24N2O/c1-10-8-14(9-11(2)13-10)6-5-12-4-3-7-15-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | BTVCNSSYWGAZHV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |