About N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide
N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide (PubChem CID 651640) has the molecular formula C23H24N4O4
and a molecular weight of 420.47 g/mol. Its IUPAC name is N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide.
Molecular Properties
| Compound Name | N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide |
| PubChem CID | 651640 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide |
| SMILES | Cn1c(-c2ccc3c(c2)OCO3)cnc1NC(=O)CCC(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C23H24N4O4/c1-27-18(17-7-8-19-20(13-17)31-15-30-19)14-25-23(27)26-22(29)10-9-21(28)24-12-11-16-5-3-2-4-6-16/h2-8,13-14H,9-12,15H2,1H3,(H,24,28)(H,25,26,29) |
| InChIKey | SRUZSXLNJZJWST-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide?
The IUPAC name of N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide (CID 651640) is N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide.
What is the SMILES notation for N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide?
The canonical SMILES for N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide is Cn1c(-c2ccc3c(c2)OCO3)cnc1NC(=O)CCC(=O)NCCc1ccccc1.
What is the InChIKey of N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide?
The InChIKey is SRUZSXLNJZJWST-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O4/c1-27-18(17-7-8-19-20(13-17)31-15-30-19)14-25-23(27)26-22(29)10-9-21(28)24-12-11-16-5-3-2-4-6-16/h2-8,13-14H,9-12,15H2,1H3,(H,24,28)(H,25,26,29).
What are the key properties of N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide?
N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide has a molecular weight of 420.47 g/mol, XLogP of 2.89, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[5-(1,3-benzodioxol-5-yl)-1-methylimidazol-2-yl]-N-(2-phenylethyl)butanediamide is sourced from PubChem (CID 651640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).