2-(4-methyl-2-oxo-1-pyridinyl)acetic acid

C8H9NO3 — CID 651661

IUPAC2-(4-methyl-2-oxo-1-pyridinyl)acetic acid
SMILESCc1ccn(CC(=O)O)c(=O)c1
InChIInChI=1S/C8H9NO3/c1-6-2-3-9(5-8(11)12)7(10)4-6/h2-4H,5H2,1H3,(H,11,12)
InChIKeyTTYWNTQPYNNGLJ-UHFFFAOYSA-N
MW167.16 g/mol
LogP0.24
Rot. Bonds2

About 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid

2-(4-methyl-2-oxo-1-pyridinyl)acetic acid (PubChem CID 651661) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid.

Molecular Properties

Compound Name2-(4-methyl-2-oxo-1-pyridinyl)acetic acid
PubChem CID651661
Molecular FormulaC8H9NO3
Molecular Weight167.16 g/mol
Exact Mass167.06
IUPAC Name2-(4-methyl-2-oxo-1-pyridinyl)acetic acid
SMILESCc1ccn(CC(=O)O)c(=O)c1
InChIInChI=1S/C8H9NO3/c1-6-2-3-9(5-8(11)12)7(10)4-6/h2-4H,5H2,1H3,(H,11,12)
InChIKeyTTYWNTQPYNNGLJ-UHFFFAOYSA-N
XLogP0.24
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500167.16
LogP ≤ 50.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid?
The IUPAC name of 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid (CID 651661) is 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid.
What is the SMILES notation for 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid?
The canonical SMILES for 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid is Cc1ccn(CC(=O)O)c(=O)c1.
What is the InChIKey of 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid?
The InChIKey is TTYWNTQPYNNGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c1-6-2-3-9(5-8(11)12)7(10)4-6/h2-4H,5H2,1H3,(H,11,12).
What are the key properties of 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid?
2-(4-methyl-2-oxo-1-pyridinyl)acetic acid has a molecular weight of 167.16 g/mol, XLogP of 0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-2-oxo-1-pyridinyl)acetic acid is sourced from PubChem (CID 651661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).