C14H28N2O2 — CID 65166537
2-[4-[3-(oxolan-2-yl)propyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 65166537) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-[4-[3-(oxolan-2-yl)propyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[3-(oxolan-2-yl)propyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 65166537 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-[4-[3-(oxolan-2-yl)propyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | OCCN1CCCN(CCCC2CCCO2)CC1 |
| InChI | InChI=1S/C14H28N2O2/c17-12-11-16-8-3-7-15(9-10-16)6-1-4-14-5-2-13-18-14/h14,17H,1-13H2 |
| InChIKey | WGMKMHROMWFJGD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |