About 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine
3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine (PubChem CID 65168755) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine.
Molecular Properties
| Compound Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine |
| PubChem CID | 65168755 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine |
| SMILES | Cc1nc(C(C(C)C)C(C)N)sc1C |
| InChI | InChI=1S/C11H20N2S/c1-6(2)10(7(3)12)11-13-8(4)9(5)14-11/h6-7,10H,12H2,1-5H3 |
| InChIKey | VPIYIJZOYLUMKY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine?
The IUPAC name of 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine (CID 65168755) is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine.
What is the SMILES notation for 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine?
The canonical SMILES for 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine is Cc1nc(C(C(C)C)C(C)N)sc1C.
What is the InChIKey of 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine?
The InChIKey is VPIYIJZOYLUMKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-6(2)10(7(3)12)11-13-8(4)9(5)14-11/h6-7,10H,12H2,1-5H3.
What are the key properties of 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine?
3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine has a molecular weight of 212.36 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethyl-1,3-thiazol-2-yl)-4-methylpentan-2-amine is sourced from PubChem (CID 65168755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).