About 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole
2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole (PubChem CID 65168760) has the molecular formula C10H16ClNS
and a molecular weight of 217.76 g/mol. Its IUPAC name is 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole |
| PubChem CID | 65168760 |
| Molecular Formula | C10H16ClNS |
| Molecular Weight | 217.76 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole |
| SMILES | CCC(Cl)C(C)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H16ClNS/c1-5-9(11)6(2)10-12-7(3)8(4)13-10/h6,9H,5H2,1-4H3 |
| InChIKey | ZXCLVJGAJRNWBP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole?
The IUPAC name of 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole (CID 65168760) is 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole?
The canonical SMILES for 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole is CCC(Cl)C(C)c1nc(C)c(C)s1.
What is the InChIKey of 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole?
The InChIKey is ZXCLVJGAJRNWBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClNS/c1-5-9(11)6(2)10-12-7(3)8(4)13-10/h6,9H,5H2,1-4H3.
What are the key properties of 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole?
2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole has a molecular weight of 217.76 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloropentan-2-yl)-4,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 65168760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).