About 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole
2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole (PubChem CID 65169100) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole |
| PubChem CID | 65169100 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(-n2ccnc2)sc1C |
| InChI | InChI=1S/C8H9N3S/c1-6-7(2)12-8(10-6)11-4-3-9-5-11/h3-5H,1-2H3 |
| InChIKey | WIHPCPQRYLOZHL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole?
The IUPAC name of 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole (CID 65169100) is 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole.
What is the SMILES notation for 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole?
The canonical SMILES for 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole is Cc1nc(-n2ccnc2)sc1C.
What is the InChIKey of 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole?
The InChIKey is WIHPCPQRYLOZHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3S/c1-6-7(2)12-8(10-6)11-4-3-9-5-11/h3-5H,1-2H3.
What are the key properties of 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole?
2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole has a molecular weight of 179.25 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-yl-4,5-dimethyl-1,3-thiazole is sourced from PubChem (CID 65169100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).