About 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one
1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one (PubChem CID 65169259) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one.
Molecular Properties
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one |
| PubChem CID | 65169259 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one |
| SMILES | Cc1nc(N2CCC(=O)CC2)sc1C |
| InChI | InChI=1S/C10H14N2OS/c1-7-8(2)14-10(11-7)12-5-3-9(13)4-6-12/h3-6H2,1-2H3 |
| InChIKey | YKWBPDAVZNYFIJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one?
The IUPAC name of 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one (CID 65169259) is 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one.
What is the SMILES notation for 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one?
The canonical SMILES for 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one is Cc1nc(N2CCC(=O)CC2)sc1C.
What is the InChIKey of 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one?
The InChIKey is YKWBPDAVZNYFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-7-8(2)14-10(11-7)12-5-3-9(13)4-6-12/h3-6H2,1-2H3.
What are the key properties of 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one?
1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one has a molecular weight of 210.30 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethyl-1,3-thiazol-2-yl)piperidin-4-one is sourced from PubChem (CID 65169259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).