About 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine
4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine (PubChem CID 65169426) has the molecular formula C12H21N3OS
and a molecular weight of 255.39 g/mol. Its IUPAC name is 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine |
| PubChem CID | 65169426 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NCCCN2CCOCC2)sc1C |
| InChI | InChI=1S/C12H21N3OS/c1-10-11(2)17-12(14-10)13-4-3-5-15-6-8-16-9-7-15/h3-9H2,1-2H3,(H,13,14) |
| InChIKey | AWIMRCMIZARPGS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine?
The IUPAC name of 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine (CID 65169426) is 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine is Cc1nc(NCCCN2CCOCC2)sc1C.
What is the InChIKey of 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine?
The InChIKey is AWIMRCMIZARPGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3OS/c1-10-11(2)17-12(14-10)13-4-3-5-15-6-8-16-9-7-15/h3-9H2,1-2H3,(H,13,14).
What are the key properties of 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine?
4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine has a molecular weight of 255.39 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 65169426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).