C11H21N5O — CID 65169439
3-ethoxy-2-ethyl-2-methyl-N-(2H-tetrazol-5-ylmethyl)cyclobutan-1-amine (PubChem CID 65169439) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 3-ethoxy-2-ethyl-2-methyl-N-(2H-tetrazol-5-ylmethyl)cyclobutan-1-amine.
| Compound Name | 3-ethoxy-2-ethyl-2-methyl-N-(2H-tetrazol-5-ylmethyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 65169439 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 3-ethoxy-2-ethyl-2-methyl-N-(2H-tetrazol-5-ylmethyl)cyclobutan-1-amine |
| SMILES | CCOC1CC(NCc2nn[nH]n2)C1(C)CC |
| InChI | InChI=1S/C11H21N5O/c1-4-11(3)8(6-9(11)17-5-2)12-7-10-13-15-16-14-10/h8-9,12H,4-7H2,1-3H3,(H,13,14,15,16) |
| InChIKey | IAQMZLXUHJSUJV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |