About 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine
3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine (PubChem CID 65169773) has the molecular formula C16H28N4O
and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine.
Molecular Properties
| Compound Name | 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine |
| PubChem CID | 65169773 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine |
| SMILES | CCOC1CC(NCCCc2ncn[nH]2)C12CCCCC2 |
| InChI | InChI=1S/C16H28N4O/c1-2-21-14-11-13(16(14)8-4-3-5-9-16)17-10-6-7-15-18-12-19-20-15/h12-14,17H,2-11H2,1H3,(H,18,19,20) |
| InChIKey | JHVJPRQDUYNYDX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine?
The IUPAC name of 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine (CID 65169773) is 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine.
What is the SMILES notation for 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine?
The canonical SMILES for 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine is CCOC1CC(NCCCc2ncn[nH]2)C12CCCCC2.
What is the InChIKey of 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine?
The InChIKey is JHVJPRQDUYNYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4O/c1-2-21-14-11-13(16(14)8-4-3-5-9-16)17-10-6-7-15-18-12-19-20-15/h12-14,17H,2-11H2,1H3,(H,18,19,20).
What are the key properties of 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine?
3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine has a molecular weight of 292.43 g/mol, XLogP of 2.45, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N-[3-(1H-1,2,4-triazol-5-yl)propyl]spiro[3.5]nonan-1-amine is sourced from PubChem (CID 65169773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).