About 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine
4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine (PubChem CID 65169861) has the molecular formula C8H12N6S
and a molecular weight of 224.29 g/mol. Its IUPAC name is 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine |
| PubChem CID | 65169861 |
| Molecular Formula | C8H12N6S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NC(C)c2nn[nH]n2)sc1C |
| InChI | InChI=1S/C8H12N6S/c1-4-6(3)15-8(9-4)10-5(2)7-11-13-14-12-7/h5H,1-3H3,(H,9,10)(H,11,12,13,14) |
| InChIKey | RWPHBQZILKGMRY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine?
The IUPAC name of 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine (CID 65169861) is 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine is Cc1nc(NC(C)c2nn[nH]n2)sc1C.
What is the InChIKey of 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine?
The InChIKey is RWPHBQZILKGMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6S/c1-4-6(3)15-8(9-4)10-5(2)7-11-13-14-12-7/h5H,1-3H3,(H,9,10)(H,11,12,13,14).
What are the key properties of 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine?
4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine has a molecular weight of 224.29 g/mol, XLogP of 1.45, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-[1-(2H-tetrazol-5-yl)ethyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 65169861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).