C22H38ClN5O2 — CID 6517012
[2-[(2Z)-2-[3-(diethylaminomethyl)-4-(2,6-dimethylanilino)-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride (PubChem CID 6517012) has the molecular formula C22H38ClN5O2 and a molecular weight of 440.03 g/mol. Its IUPAC name is [2-[(2Z)-2-[3-(diethylaminomethyl)-4-(2,6-dimethylanilino)-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride.
| Compound Name | [2-[(2Z)-2-[3-(diethylaminomethyl)-4-(2,6-dimethylanilino)-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 6517012 |
| Molecular Formula | C22H38ClN5O2 |
| Molecular Weight | 440.03 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | [2-[(2Z)-2-[3-(diethylaminomethyl)-4-(2,6-dimethylanilino)-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium chloride |
| SMILES | CCN(CC)CC(C(=O)Nc1c(C)cccc1C)/C(C)=N\NC(=O)C[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C22H37N5O2.ClH/c1-9-26(10-2)14-19(18(5)24-25-20(28)15-27(6,7)8)22(29)23-21-16(3)12-11-13-17(21)4;/h11-13,19H,9-10,14-15H2,1-8H3,(H-,23,25,28,29);1H/b24-18-; |
| InChIKey | VDHDWRRJSCBMBO-XWASNXTISA-N |
| XLogP | -0.60 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.03 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|