C15H21NO4S — CID 65170871
5-(4-tert-butylphenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 65170871) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid.
| Compound Name | 5-(4-tert-butylphenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
|---|---|
| PubChem CID | 65170871 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 5-(4-tert-butylphenyl)-1,1-dioxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(C2CS(=O)(=O)CC(C(=O)O)N2)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-15(2,3)11-6-4-10(5-7-11)12-8-21(19,20)9-13(16-12)14(17)18/h4-7,12-13,16H,8-9H2,1-3H3,(H,17,18) |
| InChIKey | CQSGYKNUABUKHX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |