C15H19NO3S — CID 65171062
6,6-dimethyl-4-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f][1,4]benzothiazine-2-carboxylic acid (PubChem CID 65171062) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 6,6-dimethyl-4-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f][1,4]benzothiazine-2-carboxylic acid.
| Compound Name | 6,6-dimethyl-4-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f][1,4]benzothiazine-2-carboxylic acid |
|---|---|
| PubChem CID | 65171062 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 6,6-dimethyl-4-oxo-1,2,3,4a,5,10b-hexahydrobenzo[f][1,4]benzothiazine-2-carboxylic acid |
| SMILES | CC1(C)CC2C(NC(C(=O)O)CS2=O)c2ccccc21 |
| InChI | InChI=1S/C15H19NO3S/c1-15(2)7-12-13(9-5-3-4-6-10(9)15)16-11(14(17)18)8-20(12)19/h3-6,11-13,16H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | GWDFCXBKTLRFTO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |