C11H19NO3S — CID 65171311
7,7-dimethyl-1-oxo-2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-3-carboxylic acid (PubChem CID 65171311) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 7,7-dimethyl-1-oxo-2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-3-carboxylic acid.
| Compound Name | 7,7-dimethyl-1-oxo-2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 65171311 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 7,7-dimethyl-1-oxo-2,3,4,4a,5,6,8,8a-octahydrobenzo[b][1,4]thiazine-3-carboxylic acid |
| SMILES | CC1(C)CCC2NC(C(=O)O)CS(=O)C2C1 |
| InChI | InChI=1S/C11H19NO3S/c1-11(2)4-3-7-9(5-11)16(15)6-8(12-7)10(13)14/h7-9,12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | TUNCXGNXQASJKD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |