About methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate
methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate (PubChem CID 65171490) has the molecular formula C14H15NO5S
and a molecular weight of 309.34 g/mol. Its IUPAC name is methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate |
| PubChem CID | 65171490 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate |
| SMILES | COC(=O)C1CS(=O)(=O)CC(c2cc3ccccc3o2)N1 |
| InChI | InChI=1S/C14H15NO5S/c1-19-14(16)11-8-21(17,18)7-10(15-11)13-6-9-4-2-3-5-12(9)20-13/h2-6,10-11,15H,7-8H2,1H3 |
| InChIKey | GVWBYWMAJHFDEN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
The IUPAC name of methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate (CID 65171490) is methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate.
What is the SMILES notation for methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
The canonical SMILES for methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate is COC(=O)C1CS(=O)(=O)CC(c2cc3ccccc3o2)N1.
What is the InChIKey of methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
The InChIKey is GVWBYWMAJHFDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO5S/c1-19-14(16)11-8-21(17,18)7-10(15-11)13-6-9-4-2-3-5-12(9)20-13/h2-6,10-11,15H,7-8H2,1H3.
What are the key properties of methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate has a molecular weight of 309.34 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1-benzofuran-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate is sourced from PubChem (CID 65171490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).