About methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate
methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate (PubChem CID 65171494) has the molecular formula C11H15NO4S2
and a molecular weight of 289.38 g/mol. Its IUPAC name is methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate |
| PubChem CID | 65171494 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate |
| SMILES | COC(=O)C1CS(=O)(=O)CC(c2sccc2C)N1 |
| InChI | InChI=1S/C11H15NO4S2/c1-7-3-4-17-10(7)8-5-18(14,15)6-9(12-8)11(13)16-2/h3-4,8-9,12H,5-6H2,1-2H3 |
| InChIKey | BKPABXZFINAFNJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
The IUPAC name of methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate (CID 65171494) is methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate.
What is the SMILES notation for methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
The canonical SMILES for methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate is COC(=O)C1CS(=O)(=O)CC(c2sccc2C)N1.
What is the InChIKey of methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
The InChIKey is BKPABXZFINAFNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4S2/c1-7-3-4-17-10(7)8-5-18(14,15)6-9(12-8)11(13)16-2/h3-4,8-9,12H,5-6H2,1-2H3.
What are the key properties of methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate?
methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate has a molecular weight of 289.38 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(3-methylthiophen-2-yl)-1,1-dioxo-1,4-thiazinane-3-carboxylate is sourced from PubChem (CID 65171494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).