About 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide
3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 65171550) has the molecular formula C5H8F3NO2S
and a molecular weight of 203.18 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 65171550 |
| Molecular Formula | C5H8F3NO2S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C5H8F3NO2S/c6-5(7,8)4-3-12(10,11)2-1-9-4/h4,9H,1-3H2 |
| InChIKey | HUOYAODNAUAQDJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide (CID 65171550) is 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide is O=S1(=O)CCNC(C(F)(F)F)C1.
What is the InChIKey of 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
The InChIKey is HUOYAODNAUAQDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO2S/c6-5(7,8)4-3-12(10,11)2-1-9-4/h4,9H,1-3H2.
What are the key properties of 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide?
3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide has a molecular weight of 203.18 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 65171550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).