C12H13NO3S — CID 65171569
1-oxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid (PubChem CID 65171569) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 1-oxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid.
| Compound Name | 1-oxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 65171569 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 1-oxo-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)C2Cc3ccccc3C2N1 |
| InChI | InChI=1S/C12H13NO3S/c14-12(15)9-6-17(16)10-5-7-3-1-2-4-8(7)11(10)13-9/h1-4,9-11,13H,5-6H2,(H,14,15) |
| InChIKey | MXWTUDLOOHCUPQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |