About N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine
N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine (PubChem CID 65171765) has the molecular formula C12H18F3N3O
and a molecular weight of 277.29 g/mol. Its IUPAC name is N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine |
| PubChem CID | 65171765 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine |
| SMILES | Cc1ncc(CNC2CC2)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C12H18F3N3O/c1-9-16-6-11(7-17-10-2-3-10)18(9)4-5-19-8-12(13,14)15/h6,10,17H,2-5,7-8H2,1H3 |
| InChIKey | PGGFCVYSBZUOIT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine?
The IUPAC name of N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine (CID 65171765) is N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine?
The canonical SMILES for N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine is Cc1ncc(CNC2CC2)n1CCOCC(F)(F)F.
What is the InChIKey of N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine?
The InChIKey is PGGFCVYSBZUOIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N3O/c1-9-16-6-11(7-17-10-2-3-10)18(9)4-5-19-8-12(13,14)15/h6,10,17H,2-5,7-8H2,1H3.
What are the key properties of N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine?
N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine has a molecular weight of 277.29 g/mol, XLogP of 2.02, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-methyl-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]methyl]cyclopropanamine is sourced from PubChem (CID 65171765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).