About 3-pyrrolidin-1-ylbenzoic acid
3-pyrrolidin-1-ylbenzoic acid (PubChem CID 651721) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-pyrrolidin-1-ylbenzoic acid.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-ylbenzoic acid |
| PubChem CID | 651721 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-pyrrolidin-1-ylbenzoic acid |
| SMILES | O=C(O)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C11H13NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h3-5,8H,1-2,6-7H2,(H,13,14) |
| InChIKey | HRVWGEKZONYEMK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-pyrrolidin-1-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-ylbenzoic acid?
The IUPAC name of 3-pyrrolidin-1-ylbenzoic acid (CID 651721) is 3-pyrrolidin-1-ylbenzoic acid.
What is the SMILES notation for 3-pyrrolidin-1-ylbenzoic acid?
The canonical SMILES for 3-pyrrolidin-1-ylbenzoic acid is O=C(O)c1cccc(N2CCCC2)c1.
What is the InChIKey of 3-pyrrolidin-1-ylbenzoic acid?
The InChIKey is HRVWGEKZONYEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h3-5,8H,1-2,6-7H2,(H,13,14).
What are the key properties of 3-pyrrolidin-1-ylbenzoic acid?
3-pyrrolidin-1-ylbenzoic acid has a molecular weight of 191.23 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-ylbenzoic acid is sourced from PubChem (CID 651721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).