C13H13ClO — CID 65172349
3-[(2-chlorophenyl)methyl]cyclohex-2-en-1-one (PubChem CID 65172349) has the molecular formula C13H13ClO and a molecular weight of 220.70 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]cyclohex-2-en-1-one.
| Compound Name | 3-[(2-chlorophenyl)methyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 65172349 |
| Molecular Formula | C13H13ClO |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]cyclohex-2-en-1-one |
| SMILES | O=C1C=C(Cc2ccccc2Cl)CCC1 |
| InChI | InChI=1S/C13H13ClO/c14-13-7-2-1-5-11(13)8-10-4-3-6-12(15)9-10/h1-2,5,7,9H,3-4,6,8H2 |
| InChIKey | FXPCQXFTXBTOEK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |