C15H19BrFN3 — CID 65173041
N-[[3-[(5-bromo-2-fluorophenyl)methyl]-2-methylimidazol-4-yl]methyl]propan-1-amine (PubChem CID 65173041) has the molecular formula C15H19BrFN3 and a molecular weight of 340.24 g/mol. Its IUPAC name is N-[[3-[(5-bromo-2-fluorophenyl)methyl]-2-methylimidazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-[(5-bromo-2-fluorophenyl)methyl]-2-methylimidazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 65173041 |
| Molecular Formula | C15H19BrFN3 |
| Molecular Weight | 340.24 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[[3-[(5-bromo-2-fluorophenyl)methyl]-2-methylimidazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(C)n1Cc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H19BrFN3/c1-3-6-18-8-14-9-19-11(2)20(14)10-12-7-13(16)4-5-15(12)17/h4-5,7,9,18H,3,6,8,10H2,1-2H3 |
| InChIKey | NLLBHHJLKLJOAA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|