C13H13F3N2O3 — CID 65173490
2,2,2-trifluoroethyl N-[4-(2-oxopyrrolidin-1-yl)phenyl]carbamate (PubChem CID 65173490) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[4-(2-oxopyrrolidin-1-yl)phenyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[4-(2-oxopyrrolidin-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 65173490 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[4-(2-oxopyrrolidin-1-yl)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(N2CCCC2=O)cc1)OCC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O3/c14-13(15,16)8-21-12(20)17-9-3-5-10(6-4-9)18-7-1-2-11(18)19/h3-6H,1-2,7-8H2,(H,17,20) |
| InChIKey | SPJBJOOZUZLSHP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |