C14H16F3NO2S — CID 65173873
2,2,2-trifluoroethyl N-(2-cyclopentylsulfanylphenyl)carbamate (PubChem CID 65173873) has the molecular formula C14H16F3NO2S and a molecular weight of 319.35 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-(2-cyclopentylsulfanylphenyl)carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-(2-cyclopentylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 65173873 |
| Molecular Formula | C14H16F3NO2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-(2-cyclopentylsulfanylphenyl)carbamate |
| SMILES | O=C(Nc1ccccc1SC1CCCC1)OCC(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2S/c15-14(16,17)9-20-13(19)18-11-7-3-4-8-12(11)21-10-5-1-2-6-10/h3-4,7-8,10H,1-2,5-6,9H2,(H,18,19) |
| InChIKey | MFPSZPOIPLBLAA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |