About 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine
3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine (PubChem CID 65174443) has the molecular formula C13H17ClN2
and a molecular weight of 236.75 g/mol. Its IUPAC name is 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine.
Molecular Properties
| Compound Name | 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine |
| PubChem CID | 65174443 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine |
| SMILES | CC1(C)CC(c2cnccc2N)=CC(Cl)C1 |
| InChI | InChI=1S/C13H17ClN2/c1-13(2)6-9(5-10(14)7-13)11-8-16-4-3-12(11)15/h3-5,8,10H,6-7H2,1-2H3,(H2,15,16) |
| InChIKey | MFGXGGVOMQJLJS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine?
The IUPAC name of 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine (CID 65174443) is 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine.
What is the SMILES notation for 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine?
The canonical SMILES for 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine is CC1(C)CC(c2cnccc2N)=CC(Cl)C1.
What is the InChIKey of 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine?
The InChIKey is MFGXGGVOMQJLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2/c1-13(2)6-9(5-10(14)7-13)11-8-16-4-3-12(11)15/h3-5,8,10H,6-7H2,1-2H3,(H2,15,16).
What are the key properties of 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine?
3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine has a molecular weight of 236.75 g/mol, XLogP of 3.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-5,5-dimethylcyclohexen-1-yl)pyridin-4-amine is sourced from PubChem (CID 65174443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).